Compound Q&A

What are the physical and chemical properties of 2,4,6-Trichlorobenzonitrile (CAS: 6575-05-9)?

Answer

2,4,6-Trichlorobenzonitrile
2,4,6-Trichlorobenzonitrile is a crystalline solid with a molecular weight of approximately 228.02 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. It exhibits limited reactivity but can undergo electrophilic substitution reactions. Its physical properties include a melting point of 76-78°C and a boiling point of 255-257°C. It is known for its low solubility and stability under normal conditions.

About

CAS No 6575-05-9
English Name 2,4,6-Trichlorobenzonitrile
Molecular Formula C7H2Cl3N
Molecular Weight 17.03 g/mol
SMILES C1=C(C=C(C(=C1Cl)C#N)Cl)Cl
InChIKey PGODHCIOIPODFE-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 2,4,6-Trichlorobenzonitrile (CAS: 6575-05-9) typically synthesized?

2,4,6-Trichlorobenzonitrile is typically synthesized through a two-step process. In the first step, ...

Compound Q&A

What industries use 2,4,6-Trichlorobenzonitrile (CAS: 6575-05-9)?

2,4,6-Trichlorobenzonitrile is used in various industries including pharmaceuticals for the synthesi...

Compound Q&A

What precautions should be taken when handling 2,4,6-Trichlorobenzonitrile (CAS: 6575-05-9)?

When handling 2,4,6-Trichlorobenzonitrile, it is important to use personal protective equipment (PPE...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...