Compound Q&A

What are the physical and chemical properties of 5-Nitro-1,2-benzoxazole (CAS: 39835-28-4)?

Answer

5-Nitro-1,2-benzoxazole
5-Nitro-1,2-benzoxazole (CAS: 39835-28-4) is a crystalline solid with a molecular weight of approximately 181.13 g/mol. It has a melting point of 242-244°C and is slightly soluble in water. This compound is relatively stable but can react with strong bases and reducing agents. It is used as a precursor in organic synthesis and in the preparation of other nitrogen-containing heterocycles.

About

CAS No 39835-28-4
English Name 5-Nitro-1,2-benzoxazole
Molecular Formula C7H4N2O3
Molecular Weight 164.12 g/mol
SMILES C1=CC2=C(C=C1[N+](=O)[O-])C=NO2
InChIKey TWOYWCWKYDYTIP-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 5-Nitro-1,2-benzoxazole (CAS: 39835-28-4) typically synthesized?

5-Nitro-1,2-benzoxazole can be synthesized by nitration of 1,2-benzoxazole. The reaction typically i...

Compound Q&A

What industries use 5-Nitro-1,2-benzoxazole (CAS: 39835-28-4)?

5-Nitro-1,2-benzoxazole (CAS: 39835-28-4) is primarily used in the pharmaceutical and chemical indus...

Compound Q&A

What precautions should be taken when handling 5-Nitro-1,2-benzoxazole (CAS: 39835-28-4)?

When handling 5-Nitro-1,2-benzoxazole (CAS: 39835-28-4), it is important to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...