Compound Q&A

What are the physical and chemical properties of 7-Oxo-1,3,5-cycloheptatrien-1-yl 4-methylbenzenesulfonate (CAS: 38768-08-0)?

Answer

7-Oxo-1,3,5-cycloheptatrien-1-yl 4-methylbenzenesulfonate
7-Oxo-1,3,5-cycloheptatrien-1-yl 4-methylbenzenesulfonate (CAS: 38768-08-0) is a solid with a crystalline form. Its molecular weight is approximately 319.2 g/mol. It has a low solubility in water but is more soluble in organic solvents. The compound is relatively stable but can undergo oxidative reactions under certain conditions. It has a melting point of around 130-132°C.

About

CAS No 38768-08-0
English Name 7-Oxo-1,3,5-cycloheptatrien-1-yl 4-methylbenzenesulfonate
Molecular Formula C14H12O4S
Molecular Weight 276.31 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)OC2=CC=CC=CC2=O
InChIKey AWUMFQREGHLKJB-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 7-Oxo-1,3,5-cycloheptatrien-1-yl 4-methylbenzenesulfonate (CAS: 38768-08-0) typically synthesized?

7-Oxo-1,3,5-cycloheptatrien-1-yl 4-methylbenzenesulfonate (CAS: 38768-08-0) is synthesized via a mul...

Compound Q&A

What industries use 7-Oxo-1,3,5-cycloheptatrien-1-yl 4-methylbenzenesulfonate (CAS: 38768-08-0)?

7-Oxo-1,3,5-cycloheptatrien-1-yl 4-methylbenzenesulfonate (CAS: 38768-08-0) is primarily used in the...

Compound Q&A

What precautions should be taken when handling 7-Oxo-1,3,5-cycloheptatrien-1-yl 4-methylbenzenesulfonate (CAS: 38768-08-0)?

When handling 7-Oxo-1,3,5-cycloheptatrien-1-yl 4-methylbenzenesulfonate (CAS: 38768-08-0), it is imp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...