Compound Q&A

What are the physical and chemical properties of Dimethyl 2,2'-[(4-methyl-1,2-phenylene)bis(oxy)]diacetate (CAS: 52589-39-6)?

Answer

Dimethyl 2,2'-[(4-methyl-1,2-phenylene)bis(oxy)]diacetate
Dimethyl 2,2'-[(4-methyl-1,2-phenylene)bis(oxy)]diacetate is a crystalline compound with a molecular weight of approximately 328.37 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. This compound is known for its low reactivity under normal conditions and is generally stable in air and light.

About

CAS No 52589-39-6
English Name Dimethyl 2,2'-[(4-methyl-1,2-phenylene)bis(oxy)]diacetate
Molecular Formula C13H16O6
Molecular Weight 268.26 g/mol
SMILES O=C(OC)COc1ccc(cc1OCC(=O)OC)C
InChIKey INCGXCFQGBLZHB-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is Dimethyl 2,2'-[(4-methyl-1,2-phenylene)bis(oxy)]diacetate (CAS: 52589-39-6) typically synthesized?

Dimethyl 2,2'-[(4-methyl-1,2-phenylene)bis(oxy)]diacetate can be synthesized through the condensatio...

Compound Q&A

What industries use Dimethyl 2,2'-[(4-methyl-1,2-phenylene)bis(oxy)]diacetate (CAS: 52589-39-6)?

Dimethyl 2,2'-[(4-methyl-1,2-phenylene)bis(oxy)]diacetate is used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling Dimethyl 2,2'-[(4-methyl-1,2-phenylene)bis(oxy)]diacetate (CAS: 52589-39-6)?

When handling Dimethyl 2,2'-[(4-methyl-1,2-phenylene)bis(oxy)]diacetate, use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...