Compound Q&A

What industries use O,O-Dimethyl O-(3,5,6-trichloro-2-pyridinyl) phosphorothioate (CAS: 5598-13-0)?

Answer

O,O-Dimethyl O-(3,5,6-trichloro-2-pyridinyl) phosphorothioate
O,O-Dimethyl O-(3,5,6-trichloro-2-pyridinyl) phosphorothioate (CAS: 5598-13-0) is primarily used in the agricultural industry as an insecticide and herbicide. It is also utilized in the pharmaceutical industry for its pesticidal properties. Additionally, it plays a role in the formulation of certain chemical products for crop protection.

About

CAS No 5598-13-0
English Name O,O-Dimethyl O-(3,5,6-trichloro-2-pyridinyl) phosphorothioate
Molecular Formula C7H7Cl3NO3PS
Molecular Weight 322.54 g/mol
SMILES COP(OC)(OC1=NC(Cl)=C(Cl)C=C1Cl)=S
InChIKey HRBKVYFZANMGRE-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of O,O-Dimethyl O-(3,5,6-trichloro-2-pyridinyl) phosphorothioate (CAS: 5598-13-0)?

O,O-Dimethyl O-(3,5,6-trichloro-2-pyridinyl) phosphorothioate is a crystalline solid with a molecula...

Compound Q&A

How is O,O-Dimethyl O-(3,5,6-trichloro-2-pyridinyl) phosphorothioate (CAS: 5598-13-0) typically synthesized?

O,O-Dimethyl O-(3,5,6-trichloro-2-pyridinyl) phosphorothioate can be synthesized through the reactio...

Compound Q&A

What precautions should be taken when handling O,O-Dimethyl O-(3,5,6-trichloro-2-pyridinyl) phosphorothioate (CAS: 5598-13-0)?

Handling O,O-Dimethyl O-(3,5,6-trichloro-2-pyridinyl) phosphorothioate (CAS: 5598-13-0) requires str...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...