Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-6-methylthieno[3,2-d]pyrimidine (CAS: 35265-82-8)?

Answer

2,4-Dichloro-6-methylthieno[3,2-d]pyrimidine
2,4-Dichloro-6-methylthieno[3,2-d]pyrimidine is a crystalline solid with a molecular weight of approximately 261.04 g/mol. It has a low solubility in water (0.1 g/L at 25°C) but is more soluble in organic solvents like ethanol and acetone. This compound shows moderate reactivity towards nucleophiles and is typically stable under normal conditions, but it can degrade in acidic or basic environments. It has a melting point of around 170-172°C.

About

CAS No 35265-82-8
English Name 2,4-Dichloro-6-methylthieno[3,2-d]pyrimidine
Molecular Formula C7H4Cl2N2S
Molecular Weight 219.1 g/mol
SMILES CC1=CC2=C(S1)C(=NC(=N2)Cl)Cl
InChIKey ZDKZDOFEASCBMV-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 2,4-Dichloro-6-methylthieno[3,2-d]pyrimidine (CAS: 35265-82-8) typically synthesized?

2,4-Dichloro-6-methylthieno[3,2-d]pyrimidine can be synthesized via the condensation reaction of 2,4...

Compound Q&A

What industries use 2,4-Dichloro-6-methylthieno[3,2-d]pyrimidine (CAS: 35265-82-8)?

2,4-Dichloro-6-methylthieno[3,2-d]pyrimidine is primarily used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-6-methylthieno[3,2-d]pyrimidine (CAS: 35265-82-8)?

When handling 2,4-Dichloro-6-methylthieno[3,2-d]pyrimidine, it is important to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...