Compound Q&A

What industries use {1,1,1-Trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamidato-kappaN}gold - triphenylphosphine (CAS: 866395-16-6)?

Answer

{1,1,1-Trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamidato-kappaN}gold - triphenylphosphine (1:1)
This compound is primarily used in the pharmaceutical industry for the synthesis of complex organic molecules. It is also utilized in the semiconductor industry for the preparation of gold-containing materials. Additionally, it finds applications in the polymer industry for the modification of polymer properties and in the sensor industry for the development of sensitive detection devices.

About

English Name {1,1,1-Trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamidato-kappaN}gold - triphenylphosphine (1:1)
Molecular Formula C20H15AuF6NO4PS2
Molecular Weight 739.4 g/mol
SMILES FC(S(=O)(=O)[N-](S(=O)(=O)C(F)(F)F)[Au+]P(c1ccccc1)(c1ccccc1)c1ccccc1)(F)F
InChIKey GJWZOHAPYGHXHP-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of {1,1,1-Trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamidato-kappaN}gold - triphenylphosphine (CAS: 866395-16-6)?

The compound has a high molecular weight and typically crystallizes in the form of a powder. It is m...

Compound Q&A

How is {1,1,1-Trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamidato-kappaN}gold - triphenylphosphine (CAS: 866395-16-6) typically synthesized?

The compound is typically synthesized via the reaction of gold salts with trifluoro-N-[(trifluoromet...

Compound Q&A

What precautions should be taken when handling {1,1,1-Trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamidato-kappaN}gold - triphenylphosphine (CAS: 866395-16-6)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...