Compound Q&A

What precautions should be taken when handling 9-Acetyl-3,6-diiodocarbazole (CAS: 606129-89-9)?

Answer

9-Acetyl-3,6-diiodocarbazole
When handling 9-Acetyl-3,6-diiodocarbazole, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a well-ventilated area away from moisture and other reagents. Fume hoods should be used during operations to minimize exposure. In case of spill, immediately clean up using appropriate absorbent materials and follow standard safety protocols. Always consult the Material Safety Data Sheet (MSDS) for detailed safety information.

About

English Name 9-Acetyl-3,6-diiodocarbazole
Molecular Formula C14H9I2NO
Molecular Weight 461.04 g/mol
SMILES CC(=O)N1C2=C(C=C(C=C2)I)C3=C1C=CC(=C3)I
InChIKey HAZMJWKYEJRBCO-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9-Acetyl-3,6-diiodocarbazole (CAS: 606129-89-9)?

9-Acetyl-3,6-diiodocarbazole is a crystalline solid with a molecular weight of approximately 428.04 ...

Compound Q&A

How is 9-Acetyl-3,6-diiodocarbazole (CAS: 606129-89-9) typically synthesized?

9-Acetyl-3,6-diiodocarbazole is typically synthesized by the iodination of 9-acetylcarbazole in the ...

Compound Q&A

What industries use 9-Acetyl-3,6-diiodocarbazole (CAS: 606129-89-9)?

9-Acetyl-3,6-diiodocarbazole finds applications in the pharmaceutical industry for its potential use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...