Compound Q&A

What are the physical and chemical properties of 3-Thiophenamine ethanedioate (2:1) (CAS: 861965-63-1)?

Answer

3-Thiophenamine ethanedioate (2:1)
3-Thiophenamine ethanedioate (2:1) (CAS: 861965-63-1) is a white crystalline solid with a molecular weight of approximately 214.24 g/mol. It has a solubility of about 2.5 g/L in water and is soluble in common organic solvents like ethanol and acetone. Chemically, it shows moderate reactivity typical of amine and carboxylic acid functionalities, making it suitable for various chemical transformations.

About

English Name 3-Thiophenamine ethanedioate (2:1)
Molecular Formula C10H12N2O4S2
Molecular Weight 288.35 g/mol
SMILES c1cscc1N.c1cscc1N.C(=O)(C(=O)O)O
InChIKey OUSJKTMSLPEDLW-UHFFFAOYSA-N
Last Updated: 2025-10-19 13:36

Related Q&A

Compound Q&A

How is 3-Thiophenamine ethanedioate (2:1) (CAS: 861965-63-1) typically synthesized?

3-Thiophenamine ethanedioate (2:1) (CAS: 861965-63-1) can be synthesized through a multistep process...

Compound Q&A

What industries use 3-Thiophenamine ethanedioate (2:1) (CAS: 861965-63-1)?

3-Thiophenamine ethanedioate (2:1) (CAS: 861965-63-1) is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling 3-Thiophenamine ethanedioate (2:1) (CAS: 861965-63-1)?

When handling 3-Thiophenamine ethanedioate (2:1) (CAS: 861965-63-1), it is crucial to use proper per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...