Compound Q&A

How should Magnesium taurate (CAS: 334824-43-0) be stored?

Answer

Magnesium taurate
Magnesium taurate (CAS: 334824-43-0) should be stored in a cool, dry place away from direct sunlight and moisture. It should be kept in a tightly sealed container to prevent moisture absorption. The optimal storage temperature is between 15°C and 25°C (59°F to 77°F). Avoid exposure to extreme temperatures, which can affect its stability.

About

English Name Magnesium taurate
Molecular Formula C4H12MgN2O6S2
Molecular Weight 272.58 g/mol
SMILES C(CS(=O)(=O)[O-])N.C(CS(=O)(=O)[O-])N.[Mg+2]
InChIKey YZURQOBSFRVSEB-UHFFFAOYSA-L
Last Updated: 2025-10-18 20:41

Related Q&A

Compound Q&A

What is Magnesium taurate (CAS: 334824-43-0)?

Magnesium taurate (CAS: 334824-43-0) is a compound composed of magnesium ions combined with taurine....

Compound Q&A

What are the main uses of Magnesium taurate (CAS: 334824-43-0)?

Magnesium taurate (CAS: 334824-43-0) is primarily used in pharmaceuticals, where it serves as a magn...

Compound Q&A

Is Magnesium taurate (CAS: 334824-43-0) safe?

Magnesium taurate (CAS: 334824-43-0) is considered safe when used as directed. It is generally well-...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...