Compound Q&A

What are the main uses of Ethyl 2-(imidazo[1,2-a]pyridin-3-yl)acetate (CAS: 101820-69-3)?

Answer

Ethyl 2-(imidazo[1,2-a]pyridin-3-yl)acetate
Ethyl 2-(imidazo[1,2-a]pyridin-3-yl)acetate (CAS: 101820-69-3) is primarily used as a synthetic intermediate in the pharmaceutical and chemical industries. It serves as a building block for the synthesis of various bioactive compounds, including potential anti-inflammatory and antiviral agents. Additionally, it has applications in the development of new pharmaceuticals and as a reagent in organic synthesis.

About

English Name Ethyl 2-(imidazo[1,2-a]pyridin-3-yl)acetate
Molecular Formula C11H12N2O2
Molecular Weight 204.23 g/mol
SMILES CCOC(=O)CC1=CN=C2N1C=CC=C2
InChIKey SFCNXCZZKZRJLZ-UHFFFAOYSA-N
Last Updated: 2025-10-18 20:41

Related Q&A

Compound Q&A

What is Ethyl 2-(imidazo[1,2-a]pyridin-3-yl)acetate (CAS: 101820-69-3)?

Ethyl 2-(imidazo[1,2-a]pyridin-3-yl)acetate (CAS: 101820-69-3) is an organic compound with a molecul...

Compound Q&A

Is Ethyl 2-(imidazo[1,2-a]pyridin-3-yl)acetate (CAS: 101820-69-3) safe?

Ethyl 2-(imidazo[1,2-a]pyridin-3-yl)acetate (CAS: 101820-69-3) is generally considered safe under pr...

Compound Q&A

How should Ethyl 2-(imidazo[1,2-a]pyridin-3-yl)acetate (CAS: 101820-69-3) be stored?

Ethyl 2-(imidazo[1,2-a]pyridin-3-yl)acetate (CAS: 101820-69-3) should be stored in a cool, dry place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...