Compound Q&A

What is 3',5'-Di-O-benzoyl-2'-deoxy-2'-fluoro-2'-methyluridine (CAS: 863329-65-1)?

Answer

3',5'-Di-O-benzoyl-2'-deoxy-2'-fluoro-2'-methyluridine
3',5'-Di-O-benzoyl-2'-deoxy-2'-fluoro-2'-methyluridine is a nucleoside derivative with a unique chemical structure. It is characterized by its specific functional groups and is not commonly found in nature. This compound is used in specialized research and pharmaceutical applications due to its unique properties.

About

English Name 3',5'-Di-O-benzoyl-2'-deoxy-2'-fluoro-2'-methyluridine
Molecular Formula C24H21FN2O7
Molecular Weight 468.44 g/mol
SMILES O=C(OC[C@H]1O[C@@H](N(C(N2)=O)C=CC2=O)[C@](C)(F)[C@@H]1OC(C3=CC=CC=C3)=O)C4=CC=CC=C4
InChIKey OUDQYAYIRAUNLO-PDKZGUECSA-N
Last Updated: 2025-10-18 20:41

Related Q&A

Compound Q&A

What are the main uses of 3',5'-Di-O-benzoyl-2'-deoxy-2'-fluoro-2'-methyluridine (CAS: 863329-65-1)?

3',5'-Di-O-benzoyl-2'-deoxy-2'-fluoro-2'-methyluridine is primarily used in research for studying nu...

Compound Q&A

Is 3',5'-Di-O-benzoyl-2'-deoxy-2'-fluoro-2'-methyluridine (CAS: 863329-65-1) safe?

3',5'-Di-O-benzoyl-2'-deoxy-2'-fluoro-2'-methyluridine is generally safe when handled with appropria...

Compound Q&A

How should 3',5'-Di-O-benzoyl-2'-deoxy-2'-fluoro-2'-methyluridine (CAS: 863329-65-1) be stored?

3',5'-Di-O-benzoyl-2'-deoxy-2'-fluoro-2'-methyluridine should be stored in a cool, dry place away fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...