Compound Q&A

What are the main uses of Ammonium 4-nitrobenzoate (CAS: 19416-70-7)?

Answer

Ammonium 4-nitrobenzoate
Ammonium 4-nitrobenzoate is primarily used as a reagent in analytical chemistry and organic synthesis. It is also utilized in the production of dyes and pigments. Additionally, it serves as a model compound in spectroscopy and as a standard in various chemical assays.

About

CAS No 19416-70-7
English Name Ammonium 4-nitrobenzoate
Molecular Formula C7H8N2O4
Molecular Weight 184.15 g/mol
SMILES C1=CC(=CC=C1C(=O)O)[N+](=O)[O-].N
InChIKey JZIWMKUVMWKKLP-UHFFFAOYSA-N
Last Updated: 2025-10-18 20:41

Related Q&A

Compound Q&A

What is Ammonium 4-nitrobenzoate (CAS: 19416-70-7)?

Ammonium 4-nitrobenzoate (CAS: 19416-70-7) is an inorganic compound with the chemical formula C7H5N0...

Compound Q&A

Is Ammonium 4-nitrobenzoate (CAS: 19416-70-7) safe?

Ammonium 4-nitrobenzoate (CAS: 19416-70-7) is generally considered safe when handled with proper pre...

Compound Q&A

How should Ammonium 4-nitrobenzoate (CAS: 19416-70-7) be stored?

Ammonium 4-nitrobenzoate (CAS: 19416-70-7) should be stored in a tightly sealed container in a cool,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...