Compound Q&A

What is Benzyl 4-hydroxypiperidine-1-carboxylate (CAS: 95798-23-5)?

Answer

Benzyl 4-hydroxypiperidine-1-carboxylate
Benzyl 4-hydroxypiperidine-1-carboxylate (CAS: 95798-23-5) is an organic compound with the molecular formula C14H18O3. It is characterized by its piperidine ring, hydroxyl group, and benzyl substituent. This compound is often used in the synthesis of various pharmaceuticals and as a precursor in organic chemistry reactions.

About

CAS No 95798-23-5
English Name Benzyl 4-hydroxypiperidine-1-carboxylate
Molecular Formula C13H17NO3
Molecular Weight 235.28 g/mol
SMILES C1CN(CCC1O)C(=O)OCC2=CC=CC=C2
InChIKey JKIUUDJOCYHIGY-UHFFFAOYSA-N
Last Updated: 2025-10-18 20:41

Related Q&A

Compound Q&A

What are the main uses of Benzyl 4-hydroxypiperidine-1-carboxylate (CAS: 95798-23-5)?

Benzyl 4-hydroxypiperidine-1-carboxylate (CAS: 95798-23-5) is primarily used as a precursor in the s...

Compound Q&A

Is Benzyl 4-hydroxypiperidine-1-carboxylate (CAS: 95798-23-5) safe?

Benzyl 4-hydroxypiperidine-1-carboxylate (CAS: 95798-23-5) is generally considered safe when handled...

Compound Q&A

How should Benzyl 4-hydroxypiperidine-1-carboxylate (CAS: 95798-23-5) be stored?

Benzyl 4-hydroxypiperidine-1-carboxylate (CAS: 95798-23-5) should be stored in a cool, dry place awa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...