Compound Q&A

What is 3-Bromo-9H-xanthen-9-one (CAS: 500286-36-2)?

Answer

3-Bromo-9H-xanthen-9-one
3-Bromo-9H-xanthen-9-one is an organic compound with the CAS number 500286-36-2. It is a yellow crystalline solid with a molecular formula of C14H9BrO2. This compound is used in various scientific and industrial applications due to its unique chemical properties.

About

English Name 3-Bromo-9H-xanthen-9-one
Molecular Formula C13H7BrO2
Molecular Weight 275.1 g/mol
SMILES C1=CC=C2C(=C1)C(=O)C3=C(O2)C=C(C=C3)Br
InChIKey UEKROUJUENOVKW-UHFFFAOYSA-N
Last Updated: 2025-10-18 20:41

Related Q&A

Compound Q&A

What are the main uses of 3-Bromo-9H-xanthen-9-one (CAS: 500286-36-2)?

3-Bromo-9H-xanthen-9-one is primarily used in pharmaceuticals for the synthesis of certain compounds...

Compound Q&A

Is 3-Bromo-9H-xanthen-9-one (CAS: 500286-36-2) safe?

3-Bromo-9H-xanthen-9-one (CAS: 500286-36-2) is generally considered safe when handled with appropria...

Compound Q&A

How should 3-Bromo-9H-xanthen-9-one (CAS: 500286-36-2) be stored?

3-Bromo-9H-xanthen-9-one (CAS: 500286-36-2) should be stored in a tightly sealed container at room t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...