Compound Q&A

What are the main uses of 5-Bromo-2-nitro-3-pyridinol (CAS: 691872-15-8)?

Answer

5-Bromo-2-nitro-3-pyridinol
5-Bromo-2-nitro-3-pyridinol is primarily used in the pharmaceutical industry for the synthesis of other compounds, particularly in the development of drug candidates. It is also used in research and development settings for medicinal chemistry and as a reagent in organic synthesis.

About

English Name 5-Bromo-2-nitro-3-pyridinol
Molecular Formula C5H3BrN2O3
Molecular Weight 218.99 g/mol
SMILES C1=C(C=NC(=C1O)[N+](=O)[O-])Br
InChIKey OOPJQYJTWRBGME-UHFFFAOYSA-N
Last Updated: 2025-10-18 20:41

Related Q&A

Compound Q&A

What is 5-Bromo-2-nitro-3-pyridinol (CAS: 691872-15-8)?

5-Bromo-2-nitro-3-pyridinol is an organic compound with the CAS number 691872-15-8. It has a chemica...

Compound Q&A

Is 5-Bromo-2-nitro-3-pyridinol (CAS: 691872-15-8) safe?

5-Bromo-2-nitro-3-pyridinol is not considered inherently toxic but requires appropriate handling due...

Compound Q&A

How should 5-Bromo-2-nitro-3-pyridinol (CAS: 691872-15-8) be stored?

5-Bromo-2-nitro-3-pyridinol should be stored in a tightly sealed container at room temperature, away...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...