Compound Q&A

How should N-[(9H-Fluoren-9-ylmethoxy)carbonyl]cysteine (CAS: 135248-89-4) be stored?

Answer

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]cysteine
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]cysteine should be stored in a cool, dry place, away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture and light exposure, which can lead to degradation of the compound.

About

English Name N-[(9H-Fluoren-9-ylmethoxy)carbonyl]cysteine
Molecular Formula C18H17NO4S
Molecular Weight 343.4 g/mol
SMILES OC(=O)[C@H](CS)NC(=O)OCC1c2ccccc2-c3ccccc13
InChIKey RMTDKXQYAKLQKF-INIZCTEOSA-N
Last Updated: 2025-10-18 20:41

Related Q&A

Compound Q&A

What is N-[(9H-Fluoren-9-ylmethoxy)carbonyl]cysteine (CAS: 135248-89-4)?

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]cysteine is a cysteine derivative with a fluorenylmethoxy carbon...

Compound Q&A

What are the main uses of N-[(9H-Fluoren-9-ylmethoxy)carbonyl]cysteine (CAS: 135248-89-4)?

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]cysteine is primarily used in the synthesis of peptides and prot...

Compound Q&A

Is N-[(9H-Fluoren-9-ylmethoxy)carbonyl]cysteine (CAS: 135248-89-4) safe?

N-[(9H-Fluoren-9-ylmethoxy)carbonyl]cysteine is generally considered safe when used properly in a la...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...