Compound Q&A

How should (2E)-3-(2,5-Difluorophenyl)acrylic acid (CAS: 112898-33-6) be stored?

Answer

(2E)-3-(2,5-Difluorophenyl)acrylic acid
(2E)-3-(2,5-Difluorophenyl)acrylic acid (CAS: 112898-33-6) should be stored in a cool, dry place, away from direct sunlight and heat sources. It is recommended to keep it in a tightly sealed container to prevent moisture absorption. It is also advisable to store it in a chemical cabinet or a secure area to prevent unauthorized access and ensure safety during transport and storage.

About

English Name (2E)-3-(2,5-Difluorophenyl)acrylic acid
Molecular Formula C9H6F2O2
Molecular Weight 184.14 g/mol
SMILES C1=CC(=C(C=C1F)C=CC(=O)O)F
InChIKey XAWHCSKPALFWBI-DAFODLJHSA-N
Last Updated: 2025-10-18 17:52

Related Q&A

Compound Q&A

What is (2E)-3-(2,5-Difluorophenyl)acrylic acid (CAS: 112898-33-6)?

(2E)-3-(2,5-Difluorophenyl)acrylic acid, also known as difluorophenylacrylic acid, is a chemical com...

Compound Q&A

What are the main uses of (2E)-3-(2,5-Difluorophenyl)acrylic acid (CAS: 112898-33-6)?

(2E)-3-(2,5-Difluorophenyl)acrylic acid (CAS: 112898-33-6) is widely used in the pharmaceutical indu...

Compound Q&A

Is (2E)-3-(2,5-Difluorophenyl)acrylic acid (CAS: 112898-33-6) safe?

(2E)-3-(2,5-Difluorophenyl)acrylic acid (CAS: 112898-33-6) is generally safe when handled with appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...