Compound Q&A

What is 5-(Trifluoromethoxy)-1H-indazole-3-carboxylic acid (CAS: 869782-94-5)?

Answer

5-(Trifluoromethoxy)-1H-indazole-3-carboxylic acid
5-(Trifluoromethoxy)-1H-indazole-3-carboxylic acid (CAS: 869782-94-5) is a derivative of indazole with a trifluoromethoxy group attached to the 5-position. It is a white solid with a pungent odor and is used in pharmaceutical research for its potential as an antiviral agent.

About

English Name 5-(Trifluoromethoxy)-1H-indazole-3-carboxylic acid
Molecular Formula C9H5F3N2O3
Molecular Weight 246.14 g/mol
SMILES OC(=O)c1n[nH]c2ccc(OC(F)(F)F)cc12
InChIKey DJKYXGHMEGLNLG-UHFFFAOYSA-N
Last Updated: 2025-10-18 17:52

Related Q&A

Compound Q&A

What are the main uses of 5-(Trifluoromethoxy)-1H-indazole-3-carboxylic acid (CAS: 869782-94-5)?

5-(Trifluoromethoxy)-1H-indazole-3-carboxylic acid (CAS: 869782-94-5) is primarily used in pharmaceu...

Compound Q&A

Is 5-(Trifluoromethoxy)-1H-indazole-3-carboxylic acid (CAS: 869782-94-5) safe?

5-(Trifluoromethoxy)-1H-indazole-3-carboxylic acid (CAS: 869782-94-5) is generally safe when handled...

Compound Q&A

How should 5-(Trifluoromethoxy)-1H-indazole-3-carboxylic acid (CAS: 869782-94-5) be stored?

5-(Trifluoromethoxy)-1H-indazole-3-carboxylic acid (CAS: 869782-94-5) should be stored in a cool, dr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...