Compound Q&A

How should 2,5-Disulfanylterephthalic acid (CAS: 25906-66-5) be stored?

Answer

2,5-Disulfanylterephthalic acid
2,5-Disulfanylterephthalic acid should be stored in a cool, dry place, away from direct sunlight and sources of heat. It is best kept in a tightly sealed container to prevent moisture uptake and degradation. Avoid contact with incompatible materials such as strong acids or bases. It should be stored at room temperature, ideally between 15-25°C (59-77°F), to maintain its stability and integrity.

About

CAS No 25906-66-5
English Name 2,5-Disulfanylterephthalic acid
Molecular Formula C8H6O4S2
Molecular Weight 230.27 g/mol
SMILES C1=C(C(=CC(=C1S)C(=O)O)S)C(=O)O
InChIKey YYGZWQNDFRCZIF-UHFFFAOYSA-N
Last Updated: 2025-10-18 17:52

Related Q&A

Compound Q&A

What is 2,5-Disulfanylterephthalic acid (CAS: 25906-66-5)?

2,5-Disulfanylterephthalic acid is a chemical compound with the CAS number 25906-66-5. It is an arom...

Compound Q&A

What are the main uses of 2,5-Disulfanylterephthalic acid (CAS: 25906-66-5)?

2,5-Disulfanylterephthalic acid is primarily used in the synthesis of polyesters and other polymers....

Compound Q&A

Is 2,5-Disulfanylterephthalic acid (CAS: 25906-66-5) safe?

2,5-Disulfanylterephthalic acid is generally considered safe for laboratory use when proper precauti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...