Compound Q&A

How should 2-Amino-3-bromo-5-methylbenzoic acid (CAS: 13091-43-5) be stored?

Answer

2-Amino-3-bromo-5-methylbenzoic acid
2-Amino-3-bromo-5-methylbenzoic acid (CAS: 13091-43-5) should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture absorption. It is also advisable to store it in a well-ventilated area to minimize the risk of spontaneous combustion.

About

CAS No 13091-43-5
English Name 2-Amino-3-bromo-5-methylbenzoic acid
Molecular Formula C8H8BrNO2
Molecular Weight 230.06 g/mol
SMILES CC1=CC(=C(C(=C1)Br)N)C(=O)O
InChIKey LCMZECCEEOQWLQ-UHFFFAOYSA-N
Last Updated: 2025-10-18 17:52

Related Q&A

Compound Q&A

What is 2-Amino-3-bromo-5-methylbenzoic acid (CAS: 13091-43-5)?

2-Amino-3-bromo-5-methylbenzoic acid (CAS: 13091-43-5) is a chemical compound with the molecular for...

Compound Q&A

What are the main uses of 2-Amino-3-bromo-5-methylbenzoic acid (CAS: 13091-43-5)?

2-Amino-3-bromo-5-methylbenzoic acid (CAS: 13091-43-5) is primarily used in the synthesis of pharmac...

Compound Q&A

Is 2-Amino-3-bromo-5-methylbenzoic acid (CAS: 13091-43-5) safe?

2-Amino-3-bromo-5-methylbenzoic acid (CAS: 13091-43-5) is generally safe when handled with appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...