Compound Q&A

What are the main uses of (2-Chloro-5-methylphenyl)boronic acid (CAS: 193353-35-4)?

Answer

(2-Chloro-5-methylphenyl)boronic acid
(2-Chloro-5-methylphenyl)boronic acid is primarily used in organic synthesis for its ability to participate in cross-coupling reactions, especially the Suzuki coupling. It is also used as a reagent in drug synthesis, materials science, and as a functional group in various chemical processes. Due to its reactivity and stability, it finds applications in the pharmaceutical and chemical industries.

About

English Name (2-Chloro-5-methylphenyl)boronic acid
Molecular Formula C7H8BClO2
Molecular Weight 170.4 g/mol
SMILES B(C1=C(C=CC(=C1)C)Cl)(O)O
InChIKey JMUXNVYJDBCLPF-UHFFFAOYSA-N
Last Updated: 2025-10-18 17:52

Related Q&A

Compound Q&A

What is (2-Chloro-5-methylphenyl)boronic acid (CAS: 193353-35-4)?

(2-Chloro-5-methylphenyl)boronic acid, also known as 5-Bromo-2-chloro-4-methylphenylboronic acid, is...

Compound Q&A

Is (2-Chloro-5-methylphenyl)boronic acid (CAS: 193353-35-4) safe?

(2-Chloro-5-methylphenyl)boronic acid is generally safe when handled with proper precautions. Howeve...

Compound Q&A

How should (2-Chloro-5-methylphenyl)boronic acid (CAS: 193353-35-4) be stored?

(2-Chloro-5-methylphenyl)boronic acid should be stored in a cool, dry place away from direct sunligh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...