Compound Q&A

What is (Chloromethyl)(triphenyl)phosphonium chloride (CAS: 5293-84-5)?

Answer

(Chloromethyl)(triphenyl)phosphonium chloride
(Chloromethyl)(triphenyl)phosphonium chloride is an organophosphorus compound with the CAS number 5293-84-5. It is a white crystalline solid with a pungent odor. This compound is typically used in organic synthesis and as a Lewis acid in various chemical reactions.

About

CAS No 5293-84-5
English Name (Chloromethyl)(triphenyl)phosphonium chloride
Molecular Formula C19H17Cl2P
Molecular Weight 347.2 g/mol
SMILES C1=CC=C(C=C1)[P+](CCl)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-]
InChIKey SXYFAZGVNNYGJQ-UHFFFAOYSA-M
Last Updated: 2025-10-18 17:52

Related Q&A

Compound Q&A

What are the main uses of (Chloromethyl)(triphenyl)phosphonium chloride (CAS: 5293-84-5)?

(Chloromethyl)(triphenyl)phosphonium chloride (CAS: 5293-84-5) is primarily used in organic synthesi...

Compound Q&A

Is (Chloromethyl)(triphenyl)phosphonium chloride (CAS: 5293-84-5) safe?

(Chloromethyl)(triphenyl)phosphonium chloride (CAS: 5293-84-5) should be handled with caution due to...

Compound Q&A

How should (Chloromethyl)(triphenyl)phosphonium chloride (CAS: 5293-84-5) be stored?

(Chloromethyl)(triphenyl)phosphonium chloride (CAS: 5293-84-5) should be stored in a cool, dry place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...