Compound Q&A

How should 3'-Carbamoyl-3-biphenylyl cyclohexylcarbamate (CAS: 546141-08-6) be stored?

Answer

3'-Carbamoyl-3-biphenylyl cyclohexylcarbamate
3'-Carbamoyl-3-biphenylyl cyclohexylcarbamate should be stored in a cool, dry place, preferably below 25°C and away from direct sunlight. It should be kept in a tightly sealed container to prevent exposure to moisture and air. Maintain a relative humidity below 50% to avoid any degradation. Avoid storing it near heat sources or any potential ignition sources.

About

English Name 3'-Carbamoyl-3-biphenylyl cyclohexylcarbamate
Molecular Formula C20H22N2O3
Molecular Weight 338.41 g/mol
SMILES C1CCC(CC1)NC(=O)OC2=CC=CC(=C2)C3=CC(=CC=C3)C(=O)N
InChIKey ROFVXGGUISEHAM-UHFFFAOYSA-N
Last Updated: 2025-10-18 17:52

Related Q&A

Compound Q&A

What is 3'-Carbamoyl-3-biphenylyl cyclohexylcarbamate (CAS: 546141-08-6)?

3'-Carbamoyl-3-biphenylyl cyclohexylcarbamate is a complex organic compound with the CAS number 5461...

Compound Q&A

What are the main uses of 3'-Carbamoyl-3-biphenylyl cyclohexylcarbamate (CAS: 546141-08-6)?

3'-Carbamoyl-3-biphenylyl cyclohexylcarbamate is primarily used in pharmaceutical research as an int...

Compound Q&A

Is 3'-Carbamoyl-3-biphenylyl cyclohexylcarbamate (CAS: 546141-08-6) safe?

3'-Carbamoyl-3-biphenylyl cyclohexylcarbamate is generally considered safe when handled properly. Ho...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...