Compound Q&A

What is the market or research trend for 2-Methyl-2-propanyl (2S)-2-carbamothioyl-1-pyrrolidinecarboxylate (CAS: 101410-18-8)?

Answer

2-Methyl-2-propanyl (2S)-2-carbamothioyl-1-pyrrolidinecarboxylate
The market for 2-Methyl-2-propanyl (2S)-2-carbamothioyl-1-pyrrolidinecarboxylate (CAS: 101410-18-8) is currently being explored in various biomedical and pharmaceutical research areas. There is a growing interest in its potential applications in drug discovery and development, particularly due to its unique chemical properties. Research trends are focusing on optimizing its synthesis, improving its pharmacokinetic and pharmacodynamic profiles, and exploring its effectiveness in treating various diseases.

About

English Name 2-Methyl-2-propanyl (2S)-2-carbamothioyl-1-pyrrolidinecarboxylate
Molecular Formula C10H18N2O2S
Molecular Weight 230.33 g/mol
SMILES CC(C)(C)OC(=O)N1CCCC1C(=S)N
InChIKey KPAOKCBKJXBXNI-ZETCQYMHSA-N
Last Updated: 2025-10-17 23:05

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-Methyl-2-propanyl (2S)-2-carbamothioyl-1-pyrrolidinecarboxylate (CAS: 101410-18-8)?

The compound 2-Methyl-2-propanyl (2S)-2-carbamothioyl-1-pyrrolidinecarboxylate (CAS: 101410-18-8) fa...

Compound Q&A

Are there alternatives to 2-Methyl-2-propanyl (2S)-2-carbamothioyl-1-pyrrolidinecarboxylate (CAS: 101410-18-8) in synthesis?

In the synthesis of various chemical compounds, 2-Methyl-2-propanyl (2S)-2-carbamothioyl-1-pyrrolidi...

Compound Q&A

How should waste containing 2-Methyl-2-propanyl (2S)-2-carbamothioyl-1-pyrrolidinecarboxylate (CAS: 101410-18-8) be handled?

Waste containing 2-Methyl-2-propanyl (2S)-2-carbamothioyl-1-pyrrolidinecarboxylate (CAS: 101410-18-8...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...