Compound Q&A

Are there alternatives to 2-Chloro-6-(trifluoromethyl)isonicotinic acid in its synthesis?

Answer

2-Chloro-6-(trifluoromethyl)isonicotinic acid
Alternatives to 2-Chloro-6-(trifluoromethyl)isonicotinic acid in its synthesis might include other isonicotinic acid derivatives such as 2-bromo-6-(trifluoromethyl)isonicotinic acid or 2-iodo-6-(trifluoromethyl)isonicotinic acid. These compounds can serve similar roles depending on the specific application. Common alternative reagents include trifluoromethyl chlorides or bromides and isonicotinic acid itself, which can be modified through various synthetic pathways to achieve the desired structure.

About

English Name 2-Chloro-6-(trifluoromethyl)isonicotinic acid
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES C1=C(C=C(N=C1C(F)(F)F)Cl)C(=O)O
InChIKey OMXMPMNUSMLQQS-UHFFFAOYSA-N
Last Updated: 2025-10-17 23:05

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-Chloro-6-(trifluoromethyl)isonicotinic acid (CAS: 796090-23-8)?

2-Chloro-6-(trifluoromethyl)isonicotinic acid (CAS: 796090-23-8) falls under the regulatory framewor...

Compound Q&A

What is the market or research trend for 2-Chloro-6-(trifluoromethyl)isonicotinic acid (CAS: 796090-23-8)?

The market for 2-Chloro-6-(trifluoromethyl)isonicotinic acid (CAS: 796090-23-8) is currently driven ...

Compound Q&A

How should waste containing 2-Chloro-6-(trifluoromethyl)isonicotinic acid (CAS: 796090-23-8) be handled?

Waste containing 2-Chloro-6-(trifluoromethyl)isonicotinic acid (CAS: 796090-23-8) should be collecte...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...