Compound Q&A

Are there alternatives to 2-Ethoxy-4-(2-methyl-2-propanyl)benzoic acid in synthesis?

Answer

2-Ethoxy-4-(2-methyl-2-propanyl)benzoic acid
Alternatives to 2-Ethoxy-4-(2-methyl-2-propanyl)benzoic acid in synthesis include various benzoic acid derivatives such as methyl benzoate and ethyl benzoate, which can serve similar functions in certain chemical reactions. Other substituents like methoxy and methyl groups can be used to modify the structure for specific applications.

About

English Name 2-Ethoxy-4-(2-methyl-2-propanyl)benzoic acid
Molecular Formula C13H18O3
Molecular Weight 222.28 g/mol
SMILES CCOC1=C(C=CC(=C1)C(C)(C)C)C(=O)O
InChIKey UZRSFWUQUGFVBS-UHFFFAOYSA-N
Last Updated: 2025-10-17 23:05

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-Ethoxy-4-(2-methyl-2-propanyl)benzoic acid (CAS: 796875-53-1)?

Regulatory guidelines for 2-Ethoxy-4-(2-methyl-2-propanyl)benzoic acid (CAS: 796875-53-1) include GH...

Compound Q&A

What is the market or research trend for 2-Ethoxy-4-(2-methyl-2-propanyl)benzoic acid (CAS: 796875-53-1)?

The market for 2-Ethoxy-4-(2-methyl-2-propanyl)benzoic acid (CAS: 796875-53-1) shows growing interes...

Compound Q&A

How should waste containing 2-Ethoxy-4-(2-methyl-2-propanyl)benzoic acid (CAS: 796875-53-1) be handled?

Waste containing 2-Ethoxy-4-(2-methyl-2-propanyl)benzoic acid (CAS: 796875-53-1) should be collected...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...