Compound Q&A

What is the market or research trend for 4-(5-(4-(Pentyloxy)phenyl)isoxazol-3-yl)benzoic acid (CAS: 179162-55-1)?

Answer

4-(5-(4-(Pentyloxy)phenyl)isoxazol-3-yl)benzoic acid
The market trend for 4-(5-(4-(Pentyloxy)phenyl)isoxazol-3-yl)benzoic acid (CAS: 179162-55-1) is driven by its use in drug discovery and pharmaceutical applications. Research is focusing on its potential as a therapeutic agent, with trends showing increased interest in personalized medicine and targeted drug delivery systems. Additionally, there is growing emphasis on sustainable and environmentally friendly synthesis methods.

About

English Name 4-(5-(4-(Pentyloxy)phenyl)isoxazol-3-yl)benzoic acid
Molecular Formula C21H21NO4
Molecular Weight 351.40200000000004 g/mol
SMILES CCCCCOC1=CC=C(C=C1)C2=CC(=NO2)C3=CC=C(C=C3)C(=O)O
InChIKey PDTXSIGPZDVVIX-UHFFFAOYSA-N
Last Updated: 2025-10-17 23:05

Related Q&A

Compound Q&A

What regulatory guidelines apply to 4-(5-(4-(Pentyloxy)phenyl)isoxazol-3-yl)benzoic acid (CAS: 179162-55-1)?

4-(5-(4-(Pentyloxy)phenyl)isoxazol-3-yl)benzoic acid (CAS: 179162-55-1) falls under the classificati...

Compound Q&A

Are there alternatives to 4-(5-(4-(Pentyloxy)phenyl)isoxazol-3-yl)benzoic acid (CAS: 179162-55-1) in synthesis?

For synthesizing similar functionalities, there are alternative reagents that can be considered as s...

Compound Q&A

How should waste containing 4-(5-(4-(Pentyloxy)phenyl)isoxazol-3-yl)benzoic acid (CAS: 179162-55-1) be handled?

Waste containing 4-(5-(4-(Pentyloxy)phenyl)isoxazol-3-yl)benzoic acid (CAS: 179162-55-1) should be c...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...