Compound Q&A

Are there alternatives to L-Glutamic acid hemimagnesium salt tetrahydrate (CAS: 18543-68-5) in synthesis?

Answer

L-Glutamic acid hemimagnesium salt tetrahydrate
Alternatives to L-Glutamic acid hemimagnesium salt tetrahydrate (CAS: 18543-68-5) in synthesis include other glutamic acid derivatives or salts, such as monohydrate or ethyl ester. Common substitutes include L-glutamic acid or other magnesium salts of amino acids, which can be used depending on the specific application and desired properties.

About

CAS No 18543-68-5
English Name L-Glutamic acid hemimagnesium salt tetrahydrate
Molecular Formula C5H7MgNO4
Molecular Weight 169.42 g/mol
SMILES C(CC(=O)[O-])C(C(=O)[O-])N.[Mg+2]
InChIKey WNPYNOGQURLHSF-DFWYDOINSA-L
Last Updated: 2025-10-17 17:23

Related Q&A

Compound Q&A

What regulatory guidelines apply to L-Glutamic acid hemimagnesium salt tetrahydrate (CAS: 18543-68-5)?

L-Glutamic acid hemimagnesium salt tetrahydrate (CAS: 18543-68-5) is subject to various regulatory g...

Compound Q&A

What is the market or research trend for L-Glutamic acid hemimagnesium salt tetrahydrate (CAS: 18543-68-5)?

Market trends for L-Glutamic acid hemimagnesium salt tetrahydrate (CAS: 18543-68-5) indicate increas...

Compound Q&A

How should waste containing L-Glutamic acid hemimagnesium salt tetrahydrate (CAS: 18543-68-5) be handled?

Waste containing L-Glutamic acid hemimagnesium salt tetrahydrate (CAS: 18543-68-5) should be handled...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...