Compound Q&A

Are there alternatives to 4-chloro-3-nitro-1H-pyridin-2-one in synthesis (CAS: 165547-79-5)?

Answer

4-chloro-3-nitro-1H-pyridin-2-one
Alternatives to 4-chloro-3-nitro-1H-pyridin-2-one (CAS 165547-79-5) in synthesis include other aromatic compounds with different functional groups, such as 4-nitro-3-chloro-1H-pyridin-2-one or related heterocycles. These can serve as substitutes depending on the specific reaction conditions and desired product properties.

About

English Name 4-chloro-3-nitro-1H-pyridin-2-one
Molecular Formula C5H3ClN2O3
Molecular Weight 174.54 g/mol
SMILES C1=CNC(=O)C(=C1Cl)[N+](=O)[O-]
InChIKey UKIZCTHOMJXNIX-UHFFFAOYSA-N
Last Updated: 2025-10-17 17:23

Related Q&A

Compound Q&A

What regulatory guidelines apply to 4-chloro-3-nitro-1H-pyridin-2-one (CAS: 165547-79-5)?

4-Chloro-3-nitro-1H-pyridin-2-one (CAS 165547-79-5) is subject to various regulatory guidelines incl...

Compound Q&A

What is the market or research trend for 4-chloro-3-nitro-1H-pyridin-2-one (CAS: 165547-79-5)?

The market and research trends for 4-chloro-3-nitro-1H-pyridin-2-one (CAS 165547-79-5) are driven by...

Compound Q&A

How should waste containing 4-chloro-3-nitro-1H-pyridin-2-one (CAS: 165547-79-5) be handled?

Waste containing 4-chloro-3-nitro-1H-pyridin-2-one (CAS 165547-79-5) should be collected and handled...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...