Compound Q&A

Are there alternatives to 8,9-Dimethoxy-6,11,12,14-tetrahydro-6aH-[1,3]dioxolo[4,5-h]isoquinolino[2,1-b]isoquinoline (CAS: 38853-67-7) in synthesis?

Answer

8,9-Dimethoxy-6,11,12,14-tetrahydro-6aH-[1,3]dioxolo[4,5-h]isoquinolino[2,1-b]isoquinoline
Alternative reagents such as 1,2-dimethoxybenzene or similar dimethoxy compounds can be used as substitutes. However, the choice of alternative depends on the specific chemical properties and the desired reaction outcome. Synthetic routes utilizing different starting materials or reagents can also be considered based on the availability and cost.

About

CAS No 38853-67-7
English Name 8,9-Dimethoxy-6,11,12,14-tetrahydro-6aH-[1,3]dioxolo[4,5-h]isoquinolino[2,1-b]isoquinoline
Molecular Formula C20H21NO4
Molecular Weight 339.39 g/mol
SMILES COC1=CC2=C(C3N(CC2)CC4=C(C=CC5=C4OCO5)C3)C=C1OC
InChIKey UWEHVAXMSWXKRW-UHFFFAOYSA-N
Last Updated: 2025-10-17 17:23

Related Q&A

Compound Q&A

What regulatory guidelines apply to 8,9-Dimethoxy-6,11,12,14-tetrahydro-6aH-[1,3]dioxolo[4,5-h]isoquinolino[2,1-b]isoquinoline (CAS: 38853-67-7)?

This compound requires adherence to the Globally Harmonized System of Classification and Labeling of...

Compound Q&A

What is the market or research trend for 8,9-Dimethoxy-6,11,12,14-tetrahydro-6aH-[1,3]dioxolo[4,5-h]isoquinolino[2,1-b]isoquinoline (CAS: 38853-67-7)?

There is increasing interest in this compound due to its potential biological activities, particular...

Compound Q&A

How should waste containing 8,9-Dimethoxy-6,11,12,14-tetrahydro-6aH-[1,3]dioxolo[4,5-h]isoquinolino[2,1-b]isoquinoline (CAS: 38853-67-7) be handled?

Waste containing this compound should be collected in appropriate containers and disposed of through...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...