Compound Q&A

Are there alternatives to [1-(Methoxycarbonyl)-1H-indol-2-yl]boronic acid (CAS: 1001162-89-5) in synthesis?

Answer

[1-(Methoxycarbonyl)-1H-indol-2-yl]boronic acid
Several alternatives can be used in synthesis, such as 2-bromomethylindole and other boronic acids with similar functionality. These alternatives can offer synthetic flexibility and may have advantages in terms of reactivity and availability. However, the choice depends on the specific requirements of the reaction and the desired product.

About

English Name [1-(Methoxycarbonyl)-1H-indol-2-yl]boronic acid
Molecular Formula C10H10BNO4
Molecular Weight 219.01 g/mol
SMILES COC(=O)n1c(cc2c1cccc2)B(O)O
InChIKey BYSPSIQMPUCCRP-UHFFFAOYSA-N
Last Updated: 2025-10-17 17:23

Related Q&A

Compound Q&A

What regulatory guidelines apply to [1-(Methoxycarbonyl)-1H-indol-2-yl]boronic acid (CAS: 1001162-89-5)?

This compound falls under the scope of the REACH regulation in the European Union, which requires re...

Compound Q&A

What is the market or research trend for [1-(Methoxycarbonyl)-1H-indol-2-yl]boronic acid (CAS: 1001162-89-5)?

The compound is gaining interest in pharmaceutical and chemical research due to its potential as a b...

Compound Q&A

How should waste containing [1-(Methoxycarbonyl)-1H-indol-2-yl]boronic acid (CAS: 1001162-89-5) be handled?

Waste containing this compound should be collected in appropriate containers and disposed of through...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...