Compound Q&A

Are there alternatives to 4-Amino-3-nitrobenzenesulfonic acid (CAS: 68909-20-6) in synthesis?

Answer

4-Amino-3-nitrobenzenesulfonic acid
There are several alternatives to 4-Amino-3-nitrobenzenesulfonic acid (CAS: 68909-20-6) in synthesis, including other sulfonic acids and derivatives. For example, 4-Nitrobenzenesulfonic acid and 3-Aminobenzenesulfonic acid can be used as precursors or substitutes. These alternatives can provide similar functional groups for various chemical reactions, but the choice depends on the specific requirements of the synthesis and the desired properties of the final product.

About

CAS No 68909-20-6
English Name 4-Amino-3-nitrobenzenesulfonic acid
Molecular Formula C6H6N2O5S
Molecular Weight 221.48 g/mol
SMILES C[Si](C)(C)N[Si](C)(C)C.O=[Si]=O
InChIKey VZLLZDZTQPBHAZ-UHFFFAOYSA-N
Last Updated: 2025-10-17 13:01

Related Q&A

Compound Q&A

What regulatory guidelines apply to 4-Amino-3-nitrobenzenesulfonic acid (CAS: 68909-20-6)?

4-Amino-3-nitrobenzenesulfonic acid (CAS: 68909-20-6) is classified as a dangerous chemical under th...

Compound Q&A

What is the market or research trend for 4-Amino-3-nitrobenzenesulfonic acid (CAS: 68909-20-6)?

The market for 4-Amino-3-nitrobenzenesulfonic acid (CAS: 68909-20-6) is showing consistent growth du...

Compound Q&A

How should waste containing 4-Amino-3-nitrobenzenesulfonic acid (CAS: 68909-20-6) be handled?

Waste containing 4-Amino-3-nitrobenzenesulfonic acid (CAS: 68909-20-6) should be collected in approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...