Compound Q&A

What is the market or research trend for Baclofen EP Impurity B (CAS: 1141-23-7)?

Answer

Baclofen EP Impurity B
The market for Baclofen EP Impurity B (CAS: 1141-23-7) is driven by its role as a byproduct in the synthesis of Baclofen, a muscle relaxant used to treat spasticity. Research trends focus on its pharmacological properties and potential applications. Market trends show a steady demand, but there is ongoing research to explore its use in new drug formulations and therapies.

About

CAS No 1141-23-7
English Name Baclofen EP Impurity B
Molecular Formula C11H12ClNO3
Molecular Weight 241.67 g/mol
SMILES C1=CC(=CC=C1C(CC(=O)N)CC(=O)O)Cl
InChIKey NLCJVRPOYTZTMS-UHFFFAOYSA-N
Last Updated: 2025-10-17 13:01

Related Q&A

Compound Q&A

What regulatory guidelines apply to Baclofen EP Impurity B (CAS: 1141-23-7)?

Baclofen EP Impurity B (CAS: 1141-23-7) is subject to regulatory guidelines such as GHS classificati...

Compound Q&A

Are there alternatives to Baclofen EP Impurity B (CAS: 1141-23-7) in synthesis?

In synthesis, alternatives to Baclofen EP Impurity B (CAS: 1141-23-7) may include similar dihydropyr...

Compound Q&A

How should waste containing Baclofen EP Impurity B (CAS: 1141-23-7) be handled?

Waste containing Baclofen EP Impurity B (CAS: 1141-23-7) should be collected in appropriate containe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...