Compound Q&A

What are the physical and chemical properties of N,N,N-Tributyl-1-butanaminium periodate (CAS: 65201-77-6)?

Answer

N,N,N-Tributyl-1-butanaminium periodate
N,N,N-Tributyl-1-butanaminium periodate (CAS: 65201-77-6) is a crystalline solid with a molecular weight of approximately 357.38 g/mol. It has a high solubility in polar solvents such as water and alcohols. Chemically, it is highly reactive, particularly towards nucleophiles, making it useful in organic transformation reactions.

About

CAS No 65201-77-6
English Name N,N,N-Tributyl-1-butanaminium periodate
Molecular Formula C16H36INO4
Molecular Weight 433.37 g/mol
SMILES CCCC[N+](CCCC)(CCCC)CCCC.[O-]I(=O)(=O)=O
InChIKey PYVXLMQALOZKES-UHFFFAOYSA-M
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is N,N,N-Tributyl-1-butanaminium periodate (CAS: 65201-77-6) typically synthesized?

N,N,N-Tributyl-1-butanaminium periodate (CAS: 65201-77-6) is typically synthesized via the periodate...

Compound Q&A

What industries use N,N,N-Tributyl-1-butanaminium periodate (CAS: 65201-77-6)?

N,N,N-Tributyl-1-butanaminium periodate (CAS: 65201-77-6) is used in various industries, including p...

Compound Q&A

What precautions should be taken when handling N,N,N-Tributyl-1-butanaminium periodate (CAS: 65201-77-6)?

When handling N,N,N-Tributyl-1-butanaminium periodate (CAS: 65201-77-6), wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...