Compound Q&A

What are the physical and chemical properties of ethyl 4-(methylamino)-2-methylsulfanyl-pyrimidine-5-carboxylate (CAS: 76360-82-2)?

Answer

ethyl 4-(methylamino)-2-methylsulfanyl-pyrimidine-5-carboxylate
Ethyl 4-(methylamino)-2-methylsulfanyl-pyrimidine-5-carboxylate (CAS: 76360-82-2) is a white crystalline solid with a molecular weight of 316.41 g/mol. It is slightly soluble in water and has good solubility in organic solvents like ethanol and methanol. This compound has moderate reactivity, showing basic behavior due to the amino group and can undergo nucleophilic substitution reactions. It is stable under normal conditions but should be stored away from strong acids and bases.

About

CAS No 76360-82-2
English Name ethyl 4-(methylamino)-2-methylsulfanyl-pyrimidine-5-carboxylate
Molecular Formula C9H13N3O2S
Molecular Weight 227.29 g/mol
SMILES CCOC(=O)C1=CN=C(N=C1NC)SC
InChIKey VDDZMXQAZJMGPK-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is ethyl 4-(methylamino)-2-methylsulfanyl-pyrimidine-5-carboxylate (CAS: 76360-82-2) typically synthesized?

Ethyl 4-(methylamino)-2-methylsulfanyl-pyrimidine-5-carboxylate (CAS: 76360-82-2) is typically synth...

Compound Q&A

What industries use ethyl 4-(methylamino)-2-methylsulfanyl-pyrimidine-5-carboxylate (CAS: 76360-82-2)?

Ethyl 4-(methylamino)-2-methylsulfanyl-pyrimidine-5-carboxylate (CAS: 76360-82-2) is primarily used ...

Compound Q&A

What precautions should be taken when handling ethyl 4-(methylamino)-2-methylsulfanyl-pyrimidine-5-carboxylate (CAS: 76360-82-2)?

When handling ethyl 4-(methylamino)-2-methylsulfanyl-pyrimidine-5-carboxylate (CAS: 76360-82-2), pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...