Compound Q&A

What are the physical and chemical properties of Bis[9-(diethylamino)-5H-benzo[a]phenoxazin-5-iminium] sulfate (CAS: 3625-57-8)?

Answer

Bis[9-(diethylamino)-5H-benzo[a]phenoxazin-5-iminium] sulfate
Bis[9-(diethylamino)-5H-benzo[a]phenoxazin-5-iminium] sulfate is a solid with a crystalline form. Its molecular weight is approximately 609.84 g/mol. This compound has a low solubility in water but good solubility in organic solvents like dimethyl sulfoxide (DMSO). It is mildly reactive and does not typically undergo spontaneous chemical reactions at room temperature.

About

CAS No 3625-57-8
English Name Bis[9-(diethylamino)-5H-benzo[a]phenoxazin-5-iminium] sulfate
Molecular Formula C40H40N6O6S
Molecular Weight 732.8 g/mol
SMILES CC[N+](=C1C=CC2=NC3=C(C=C(C4=CC=CC=C43)N)OC2=C1)CC.CC[N+](=C1C=CC2=NC3=C(C=C(C4=CC=CC=C43)N)OC2=C1)CC.[O-]S(=O)(=O)[O-]
InChIKey QIRDPEPUXNCOLD-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is Bis[9-(diethylamino)-5H-benzo[a]phenoxazin-5-iminium] sulfate (CAS: 3625-57-8) typically synthesized?

Bis[9-(diethylamino)-5H-benzo[a]phenoxazin-5-iminium] sulfate can be synthesized through the condens...

Compound Q&A

What industries use Bis[9-(diethylamino)-5H-benzo[a]phenoxazin-5-iminium] sulfate (CAS: 3625-57-8)?

Bis[9-(diethylamino)-5H-benzo[a]phenoxazin-5-iminium] sulfate is utilized in pharmaceuticals for its...

Compound Q&A

What precautions should be taken when handling Bis[9-(diethylamino)-5H-benzo[a]phenoxazin-5-iminium] sulfate (CAS: 3625-57-8)?

When handling Bis[9-(diethylamino)-5H-benzo[a]phenoxazin-5-iminium] sulfate, it is important to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...