Compound Q&A

What are the physical and chemical properties of Lead(II) isooctanoate (CAS: 64504-12-7)?

Answer

Lead(II) isooctanoate
Lead(II) isooctanoate (CAS: 64504-12-7) is a crystalline compound with a molecular weight of approximately 306.27 g/mol. It has a low solubility in water but is soluble in organic solvents. Chemically, it is less reactive compared to other lead compounds, showing limited reactivity under normal conditions.

About

CAS No 64504-12-7
English Name Lead(II) isooctanoate
Molecular Formula C16H30O4Pb
Molecular Weight 493 g/mol
SMILES CC(C)CCCCC(=O)[O-].CC(C)CCCCC(=O)[O-].[Pb+2]
InChIKey DMTRWFMFBIMXBX-UHFFFAOYSA-L
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is Lead(II) isooctanoate (CAS: 64504-12-7) typically synthesized?

Lead(II) isooctanoate is typically synthesized by reacting lead acetate with isooctanoic acid in the...

Compound Q&A

What industries use Lead(II) isooctanoate (CAS: 64504-12-7)?

Lead(II) isooctanoate (CAS: 64504-12-7) is primarily used in the catalytic industry, particularly in...

Compound Q&A

What precautions should be taken when handling Lead(II) isooctanoate (CAS: 64504-12-7)?

When handling Lead(II) isooctanoate (CAS: 64504-12-7), appropriate personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...