Compound Q&A

What industries use 2-Methyl-2-propanyl 4-(2-methoxy-2-oxoethyl)-1-piperidinecarboxylate (CAS: 175213-46-4)?

Answer

2-Methyl-2-propanyl 4-(2-methoxy-2-oxoethyl)-1-piperidinecarboxylate
2-Methyl-2-propanyl 4-(2-methoxy-2-oxoethyl)-1-piperidinecarboxylate is primarily used in the pharmaceutical industry for the synthesis of various drugs. It also finds applications in polymer chemistry for developing novel materials with specific properties. Additionally, it is used in the sensor industry for its reactivity and in semiconductor manufacturing due to its chemical functionality.

About

English Name 2-Methyl-2-propanyl 4-(2-methoxy-2-oxoethyl)-1-piperidinecarboxylate
Molecular Formula C13H23NO4
Molecular Weight 257.33 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)CC(=O)OC
InChIKey ADFSCQGCEAKLOE-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-(2-methoxy-2-oxoethyl)-1-piperidinecarboxylate (CAS: 175213-46-4)?

2-Methyl-2-propanyl 4-(2-methoxy-2-oxoethyl)-1-piperidinecarboxylate is a crystalline solid with a m...

Compound Q&A

How is 2-Methyl-2-propanyl 4-(2-methoxy-2-oxoethyl)-1-piperidinecarboxylate (CAS: 175213-46-4) typically synthesized?

2-Methyl-2-propanyl 4-(2-methoxy-2-oxoethyl)-1-piperidinecarboxylate is typically synthesized via a ...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 4-(2-methoxy-2-oxoethyl)-1-piperidinecarboxylate (CAS: 175213-46-4)?

When handling 2-Methyl-2-proanyl 4-(2-methoxy-2-oxoethyl)-1-piperidinecarboxylate, it is important t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...