Compound Q&A

How is (1R,3S)-3-{[(tert-butoxy)carbonyl]amino}cyclopentane-1-carboxylic acid (CAS: 161660-94-2) typically synthesized?

Answer

(1R,3S)-3-{[(tert-butoxy)carbonyl]amino}cyclopentane-1-carboxylic acid
It is synthesized via a multi-step process, starting from cyclopentanecarboxylic acid and a protecting group such as BOC (tert-butoxycarbonyl) using standard coupling reactions. The specific synthesis involves protecting the amino group, followed by the introduction of the tert-butoxy carbonyl group, and subsequent deprotection to yield the final product.

About

English Name (1R,3S)-3-{[(tert-butoxy)carbonyl]amino}cyclopentane-1-carboxylic acid
Molecular Formula C11H19NO4
Molecular Weight 229.27599999999995 g/mol
SMILES CC(C)(C)OC(=O)NC1CCC(C1)C(=O)O
InChIKey RNJQBGXOSAQQDG-SFYZADRCSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1R,3S)-3-{[(tert-butoxy)carbonyl]amino}cyclopentane-1-carboxylic acid (CAS: 161660-94-2)?

This compound is a white crystalline solid with a molecular weight of approximately 268.4 g/mol. It ...

Compound Q&A

What industries use (1R,3S)-3-{[(tert-butoxy)carbonyl]amino}cyclopentane-1-carboxylic acid (CAS: 161660-94-2)?

This compound is primarily used in the pharmaceutical industry for the synthesis of biologically act...

Compound Q&A

What precautions should be taken when handling (1R,3S)-3-{[(tert-butoxy)carbonyl]amino}cyclopentane-1-carboxylic acid (CAS: 161660-94-2)?

It should be handled in a well-ventilated area with appropriate personal protective equipment (PPE),...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...