Compound Q&A

How is (-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane (CAS: 528565-79-9) typically synthesized?

Answer

(-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane
(-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane is typically synthesized via a Wittig-type reaction, where the 1,2-diphenylphospholane is reacted with a suitable aldehyde or ketone in the presence of a strong base like sodium hydride. The reaction yields the compound in good yield with high stereoselectivity, and the use of chiral auxiliaries can further enhance the stereoselectivity. The reaction is typically carried out in an inert solvent like dichloromethane under anhydrous conditions.

About

English Name (-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane
Molecular Formula C34H36P2
Molecular Weight 506.61 g/mol
SMILES C1CC(P(C1C2=CC=CC=C2)CCP3C(CCC3C4=CC=CC=C4)C5=CC=CC=C5)C6=CC=CC=C6
InChIKey VHHAZLMVLLIMHT-YFRBGRBWSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane (CAS: 528565-79-9)?

(-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane is a crystalline compound with a molecular weight...

Compound Q&A

What industries use (-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane (CAS: 528565-79-9)?

(-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane is primarily used in the pharmaceutical and chemi...

Compound Q&A

What precautions should be taken when handling (-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane (CAS: 528565-79-9)?

When handling (-)-1,2-Bis((2R,5R)-2,5-diphenylphospholano)ethane, it is important to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...