Compound Q&A

What precautions should be taken when handling 6-Fluoro-2-(2-oxiranyl)chromane (CAS: 99199-93-6)?

Answer

6-Fluoro-2-(2-oxiranyl)chromane
When handling 6-Fluoro-2-(2-oxiranyl)chromane, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. This compound should be handled in a well-ventilated area or within a fume hood to minimize exposure. Spills should be cleaned up immediately using appropriate spill kits, and the material safety data sheet (MSDS) should be consulted for detailed safety information and disposal procedures.

About

CAS No 99199-90-3
English Name 6-Fluoro-2-(2-oxiranyl)chromane
Molecular Formula C11H11FO2
Molecular Weight 194.2 g/mol
SMILES C1CC2=C(C=CC(=C2)F)OC1C3CO3
InChIKey GVZDIJGBXSDSEP-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Fluoro-2-(2-oxiranyl)chromane (CAS: 99199-93-6)?

6-Fluoro-2-(2-oxiranyl)chromane is a crystalline solid with a molecular weight of approximately 206....

Compound Q&A

How is 6-Fluoro-2-(2-oxiranyl)chromane (CAS: 99199-93-6) typically synthesized?

6-Fluoro-2-(2-oxiranyl)chromane is synthesized through the condensation of 6-fluoro-2-chromanone wit...

Compound Q&A

What industries use 6-Fluoro-2-(2-oxiranyl)chromane (CAS: 99199-93-6)?

6-Fluoro-2-(2-oxiranyl)chromane finds applications in various industries. It is used in the pharmace...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...