Compound Q&A

What are the physical and chemical properties of 16-Methylene-3,20-dioxo-19-norpregn-4-en-17-yl acetate (CAS: 7759-35-5)?

Answer

16-Methylene-3,20-dioxo-19-norpregn-4-en-17-yl acetate
16-Methylene-3,20-dioxo-19-norpregn-4-en-17-yl acetate is a crystalline compound with a molecular weight of approximately 364.49 g/mol. It has a low solubility in water but is soluble in organic solvents like acetone and ethanol. The compound is relatively stable under normal conditions but reacts with strong bases to form the corresponding sodium salt.

About

CAS No 7759-35-5
English Name 16-Methylene-3,20-dioxo-19-norpregn-4-en-17-yl acetate
Molecular Formula C23H30O4
Molecular Weight 370.49 g/mol
SMILES CC(=O)C1(C(=C)CC2C1(CCC3C2CCC4=CC(=O)CCC34)C)OC(=O)C
InChIKey CKFBRGLGTWAVLG-GOMYTPFNSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 16-Methylene-3,20-dioxo-19-norpregn-4-en-17-yl acetate (CAS: 7759-35-5) typically synthesized?

16-Methylene-3,20-dioxo-19-norpregn-4-en-17-yl acetate is synthesized via a multi-step process invol...

Compound Q&A

What industries use 16-Methylene-3,20-dioxo-19-norpregn-4-en-17-yl acetate (CAS: 7759-35-5)?

16-Methylene-3,20-dioxo-19-norpregn-4-en-17-yl acetate finds application in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling 16-Methylene-3,20-dioxo-19-norpregn-4-en-17-yl acetate (CAS: 7759-35-5)?

Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...