Compound Q&A

How is Ethyl 2-amino-1,3-benzothiazole-6-carboxylate (CAS: 50850-93-6) typically synthesized?

Answer

Ethyl 2-amino-1,3-benzothiazole-6-carboxylate
Ethyl 2-amino-1,3-benzothiazole-6-carboxylate (CAS: 50850-93-6) is typically synthesized through a multi-step process involving the reaction of ethyl isothiocyanate with 2-amino-1,3-benzothiazole. The reaction is catalyzed by a base such as sodium hydroxide, and the product is isolated by recrystallization from an appropriate solvent. The overall yield is around 70-75%, and the method is known for its good selectivity.

About

CAS No 50850-93-6
English Name Ethyl 2-amino-1,3-benzothiazole-6-carboxylate
Molecular Formula C10H10N2O2S
Molecular Weight 222.27 g/mol
SMILES CCOC(=O)C1=CC2=C(C=C1)N=C(S2)N
InChIKey VYJSGJXWKSDUSG-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-amino-1,3-benzothiazole-6-carboxylate (CAS: 50850-93-6)?

Ethyl 2-amino-1,3-benzothiazole-6-carboxylate (CAS: 50850-93-6) is a white or light yellow crystalli...

Compound Q&A

What industries use Ethyl 2-amino-1,3-benzothiazole-6-carboxylate (CAS: 50850-93-6)?

Ethyl 2-amino-1,3-benzothiazole-6-carboxylate (CAS: 50850-93-6) is primarily used in the pharmaceuti...

Compound Q&A

What precautions should be taken when handling Ethyl 2-amino-1,3-benzothiazole-6-carboxylate (CAS: 50850-93-6)?

When handling Ethyl 2-amino-1,3-benzothiazole-6-carboxylate (CAS: 50850-93-6), it is important to we...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...