Compound Q&A

What are the physical and chemical properties of 5,12-Tetracenedione (CAS: 1090-13-7)?

Answer

5,12-Tetracenedione
5,12-Tetracenedione (CAS: 1090-13-7) is a crystalline compound with a molecular weight of approximately 202.28 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. This compound is known for its high stability and low reactivity under normal conditions, making it suitable for various applications in organic synthesis and material science.

About

CAS No 1090-13-7
English Name 5,12-Tetracenedione
Molecular Formula C18H10O2
Molecular Weight 258.28 g/mol
SMILES C1=CC=C2C=C3C(=CC2=C1)C(=O)C4=CC=CC=C4C3=O
InChIKey LZPBKINTWROMEA-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is 5,12-Tetracenedione (CAS: 1090-13-7) typically synthesized?

5,12-Tetracenedione (CAS: 1090-13-7) is typically synthesized via the Wittig reaction or Claisen con...

Compound Q&A

What industries use 5,12-Tetracenedione (CAS: 1090-13-7)?

5,12-Tetracenedione (CAS: 1090-13-7) is used in the pharmaceutical, polymer, and semiconductor indus...

Compound Q&A

What precautions should be taken when handling 5,12-Tetracenedione (CAS: 1090-13-7)?

When handling 5,12-Tetracenedione (CAS: 1090-13-7), it is essential to use personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...