Compound Q&A

What industries use 2-Chloro-5-nitro-4-pyridinamine (CAS: 2604-39-9)?

Answer

2-Chloro-5-nitro-4-pyridinamine
2-Chloro-5-nitro-4-pyridinamine is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It also finds applications in the sensor industry for the development of chemical sensors, and in the research of new materials for their potential use in semiconductor technology.

About

CAS No 2604-39-9
English Name 2-Chloro-5-nitro-4-pyridinamine
Molecular Formula C5H4ClN3O2
Molecular Weight 173.56 g/mol
SMILES C1=C(C(=CN=C1Cl)[N+](=O)[O-])N
InChIKey YKWBEPUOVBMENG-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-5-nitro-4-pyridinamine (CAS: 2604-39-9)?

2-Chloro-5-nitro-4-pyridinamine is a crystalline solid with a molecular weight of approximately 225....

Compound Q&A

How is 2-Chloro-5-nitro-4-pyridinamine (CAS: 2604-39-9) typically synthesized?

2-Chloro-5-nitro-4-pyridinamine can be synthesized via the nitration of 2-chloro-4-pyridinamine foll...

Compound Q&A

What precautions should be taken when handling 2-Chloro-5-nitro-4-pyridinamine (CAS: 2604-39-9)?

When handling 2-Chloro-5-nitro-4-pyridinamine, it is essential to use appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...