Compound Q&A

How is Alogliptin Impurity 3 (CAS: 56700-70-0) typically synthesized?

Answer

Alogliptin Impurity 3
Alogliptin Impurity 3 is typically synthesized through a multi-step process involving key reactions such as halogenation, nucleophilic substitution, and condensation. The synthesis often employs catalysts like palladium and requires precise control over conditions to achieve high yield and selectivity.

About

CAS No 56700-70-0
English Name Alogliptin Impurity 3
Molecular Formula C10H14N2O2
Molecular Weight 194.23 g/mol
SMILES CC(C)(C)OC(=O)NC1=CN=CC=C1
InChIKey WKHGDPZRLXDVMJ-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Alogliptin Impurity 3 (CAS: 56700-70-0)?

Alogliptin Impurity 3 is a crystalline solid with a molecular weight of approximately 368.41 g/mol. ...

Compound Q&A

What industries use Alogliptin Impurity 3 (CAS: 56700-70-0)?

Alogliptin Impurity 3 is primarily used in the pharmaceutical industry, specifically in quality cont...

Compound Q&A

What precautions should be taken when handling Alogliptin Impurity 3 (CAS: 56700-70-0)?

When handling Alogliptin Impurity 3, it is important to wear appropriate personal protective equipme...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...