Compound Q&A

What are the physical and chemical properties of N-(4-Chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine hydrochloride (CAS: 212141-51-0)?

Answer

N-(4-Chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine hydrochloride (1:1)
N-(4-Chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine hydrochloride is a crystalline compound with a molecular weight of approximately 445.8 g/mol. It has a low solubility in water but is more soluble in organic solvents like methanol and ethanol. This compound is relatively stable under normal conditions but reacts with bases to form the corresponding free base. It is used in pharmaceutical applications and has a hydrochloride salt form.

About

English Name N-(4-Chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine hydrochloride (1:1)
Molecular Formula C20H16Cl2N4
Molecular Weight 383.28 g/mol
SMILES C1=CC=C2C(=C1)C(=NN=C2NC3=CC=C(C=C3)Cl)CC4=CC=NC=C4.Cl.Cl
InChIKey BDKWVFXIGVUEGA-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

How is N-(4-Chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine hydrochloride (CAS: 212141-51-0) typically synthesized?

N-(4-Chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine hydrochloride is synthesized through a mu...

Compound Q&A

What industries use N-(4-Chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine hydrochloride (CAS: 212141-51-0)?

N-(4-Chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine hydrochloride is primarily used in the ph...

Compound Q&A

What precautions should be taken when handling N-(4-Chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine hydrochloride (CAS: 212141-51-0)?

When handling N-(4-Chlorophenyl)-4-(4-pyridinylmethyl)-1-phthalazinamine hydrochloride, it is import...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...