Compound Q&A

What industries use 7-Bromo-4-chlorothieno[3,2-d]pyrimidine (CAS: 31169-27-4)?

Answer

7-Bromo-4-chlorothieno[3,2-d]pyrimidine
7-Bromo-4-chlorothieno[3,2-d]pyrimidine is primarily used in the pharmaceutical industry, where it serves as a key intermediate in the synthesis of various drugs. It is also of interest in the chemical and materials industry for its potential applications in polymer synthesis and as a functional material in sensor technology.

About

CAS No 31169-27-4
English Name 7-Bromo-4-chlorothieno[3,2-d]pyrimidine
Molecular Formula C6H2BrClN2S
Molecular Weight 249.52 g/mol
SMILES C1=C(C2=C(S1)C(=NC=N2)Cl)Br
InChIKey LJFZDPZIIKOATA-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Bromo-4-chlorothieno[3,2-d]pyrimidine (CAS: 31169-27-4)?

7-Bromo-4-chlorothieno[3,2-d]pyrimidine is a crystalline solid with a molecular weight of approximat...

Compound Q&A

How is 7-Bromo-4-chlorothieno[3,2-d]pyrimidine (CAS: 31169-27-4) typically synthesized?

7-Bromo-4-chlorothieno[3,2-d]pyrimidine is typically synthesized via a multi-step process involving ...

Compound Q&A

What precautions should be taken when handling 7-Bromo-4-chlorothieno[3,2-d]pyrimidine (CAS: 31169-27-4)?

When handling 7-Bromo-4-chlorothieno[3,2-d]pyrimidine, it is essential to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...