Compound Q&A

What precautions should be taken when handling (1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl)phosphonic acid (CAS: 114084-78-5)?

Answer

{1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl}phosphonic acid
When handling (1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl)phosphonic acid, it is essential to use appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work within a fume hood to minimize exposure. Spills should be managed with caution using absorbent materials, and the area should be well-ventilated. Always consult the Material Safety Data Sheet (MSDS/SDS) for specific safety information and emergency procedures.

About

English Name {1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl}phosphonic acid
Molecular Formula C9H23NO7P2
Molecular Weight 319.23 g/mol
SMILES CCCCCN(C)CCC(O)(P(=O)(O)O)P(=O)(O)O
InChIKey MPBVHIBUJCELCL-UHFFFAOYSA-N
Last Updated: 2025-10-17 07:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl)phosphonic acid (CAS: 114084-78-5)?

(1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl)phosphonic acid is a colorless crystalline comp...

Compound Q&A

How is (1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl)phosphonic acid (CAS: 114084-78-5) typically synthesized?

(1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl)phosphonic acid is synthesized via a multi-step...

Compound Q&A

What industries use (1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl)phosphonic acid (CAS: 114084-78-5)?

(1-hydroxy-3-[methyl(pentyl)amino]-1-phosphonopropyl)phosphonic acid is used in various industries i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...